C19H34IN5O2 — CID 111770817
tert-butyl N-[3-[[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]methyl]pentan-3-yl]carbamate;hydroiodide (PubChem CID 111770817) has the molecular formula C19H34IN5O2 and a molecular weight of 491.42 g/mol. Its IUPAC name is tert-butyl N-[3-[[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]methyl]pentan-3-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]methyl]pentan-3-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111770817 |
| Molecular Formula | C19H34IN5O2 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | tert-butyl N-[3-[[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]methyl]pentan-3-yl]carbamate;hydroiodide |
| SMILES | CCC(CC)(CN/C(=N\C)NCc1ccccn1)NC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C19H33N5O2.HI/c1-7-19(8-2,24-17(25)26-18(3,4)5)14-23-16(20-6)22-13-15-11-9-10-12-21-15;/h9-12H,7-8,13-14H2,1-6H3,(H,24,25)(H2,20,22,23);1H |
| InChIKey | RJGDBIZXDPWKOU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|