C14H23IN4O2 — CID 110969189
ethyl 4-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]butanoate;hydroiodide (PubChem CID 110969189) has the molecular formula C14H23IN4O2 and a molecular weight of 406.27 g/mol. Its IUPAC name is ethyl 4-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]butanoate;hydroiodide.
| Compound Name | ethyl 4-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]butanoate;hydroiodide |
|---|---|
| PubChem CID | 110969189 |
| Molecular Formula | C14H23IN4O2 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | ethyl 4-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]butanoate;hydroiodide |
| SMILES | CCOC(=O)CCCN/C(=N\C)NCc1ccccn1.I |
| InChI | InChI=1S/C14H22N4O2.HI/c1-3-20-13(19)8-6-10-17-14(15-2)18-11-12-7-4-5-9-16-12;/h4-5,7,9H,3,6,8,10-11H2,1-2H3,(H2,15,17,18);1H |
| InChIKey | LXXRXDXVCIWIIS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|