C14H21IN6 — CID 110971292
2-methyl-1-(3-pyrazol-1-ylpropyl)-3-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110971292) has the molecular formula C14H21IN6 and a molecular weight of 400.27 g/mol. Its IUPAC name is 2-methyl-1-(3-pyrazol-1-ylpropyl)-3-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(3-pyrazol-1-ylpropyl)-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110971292 |
| Molecular Formula | C14H21IN6 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 2-methyl-1-(3-pyrazol-1-ylpropyl)-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1cccn1)NCc1ccccn1.I |
| InChI | InChI=1S/C14H20N6.HI/c1-15-14(18-12-13-6-2-3-7-16-13)17-8-4-10-20-11-5-9-19-20;/h2-3,5-7,9,11H,4,8,10,12H2,1H3,(H2,15,17,18);1H |
| InChIKey | UTNMIGGXKSIGGY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|