C15H23IN6 — CID 111193105
2-methyl-1-(3-pyrazol-1-ylpropyl)-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111193105) has the molecular formula C15H23IN6 and a molecular weight of 414.30 g/mol. Its IUPAC name is 2-methyl-1-(3-pyrazol-1-ylpropyl)-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(3-pyrazol-1-ylpropyl)-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111193105 |
| Molecular Formula | C15H23IN6 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-methyl-1-(3-pyrazol-1-ylpropyl)-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1cccn1)NCCc1ccccn1.I |
| InChI | InChI=1S/C15H22N6.HI/c1-16-15(18-9-4-12-21-13-5-10-20-21)19-11-7-14-6-2-3-8-17-14;/h2-3,5-6,8,10,13H,4,7,9,11-12H2,1H3,(H2,16,18,19);1H |
| InChIKey | QYTXGEZBSRGTAG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|