C20H31N5O — CID 111906267
1-[2-(4-butoxyphenyl)ethyl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111906267) has the molecular formula C20H31N5O and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-[2-(4-butoxyphenyl)ethyl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 1-[2-(4-butoxyphenyl)ethyl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111906267 |
| Molecular Formula | C20H31N5O |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 1-[2-(4-butoxyphenyl)ethyl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine |
| SMILES | CCCCOc1ccc(CCN/C(=N/C)NCCCn2cccn2)cc1 |
| InChI | InChI=1S/C20H31N5O/c1-3-4-17-26-19-9-7-18(8-10-19)11-14-23-20(21-2)22-12-5-15-25-16-6-13-24-25/h6-10,13,16H,3-5,11-12,14-15,17H2,1-2H3,(H2,21,22,23) |
| InChIKey | AHBKIFSPXFULRL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|