C22H33IN6 — CID 111192249
2-methyl-1-[3-(4-phenylpiperazin-1-yl)propyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111192249) has the molecular formula C22H33IN6 and a molecular weight of 508.45 g/mol. Its IUPAC name is 2-methyl-1-[3-(4-phenylpiperazin-1-yl)propyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-(4-phenylpiperazin-1-yl)propyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111192249 |
| Molecular Formula | C22H33IN6 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 2-methyl-1-[3-(4-phenylpiperazin-1-yl)propyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCN(c2ccccc2)CC1)NCCc1ccccn1.I |
| InChI | InChI=1S/C22H32N6.HI/c1-23-22(26-14-11-20-8-5-6-12-24-20)25-13-7-15-27-16-18-28(19-17-27)21-9-3-2-4-10-21;/h2-6,8-10,12H,7,11,13-19H2,1H3,(H2,23,25,26);1H |
| InChIKey | PBNMUXRLOJTZOQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|