C21H36N6O2 — CID 111192556
tert-butyl 4-[3-[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]propyl]piperazine-1-carboxylate (PubChem CID 111192556) has the molecular formula C21H36N6O2 and a molecular weight of 404.56 g/mol. Its IUPAC name is tert-butyl 4-[3-[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111192556 |
| Molecular Formula | C21H36N6O2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | tert-butyl 4-[3-[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]propyl]piperazine-1-carboxylate |
| SMILES | C/N=C(/NCCCN1CCN(C(=O)OC(C)(C)C)CC1)NCCc1ccccn1 |
| InChI | InChI=1S/C21H36N6O2/c1-21(2,3)29-20(28)27-16-14-26(15-17-27)13-7-11-24-19(22-4)25-12-9-18-8-5-6-10-23-18/h5-6,8,10H,7,9,11-17H2,1-4H3,(H2,22,24,25) |
| InChIKey | IWAWUJPTBLFEGR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|