C15H25N5O — CID 111193428
N-tert-butyl-2-[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]acetamide (PubChem CID 111193428) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111193428 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(/NCCc1ccccn1)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H25N5O/c1-15(2,3)20-13(21)11-19-14(16-4)18-10-8-12-7-5-6-9-17-12/h5-7,9H,8,10-11H2,1-4H3,(H,20,21)(H2,16,18,19) |
| InChIKey | ROVYIVRGVOJGJA-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|