C16H25F3N6O — CID 111385124
N-tert-butyl-2-[[N'-methyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]carbamimidoyl]amino]acetamide (PubChem CID 111385124) has the molecular formula C16H25F3N6O and a molecular weight of 374.41 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111385124 |
| Molecular Formula | C16H25F3N6O |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(/NCCNc1ncccc1C(F)(F)F)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H25F3N6O/c1-15(2,3)25-12(26)10-24-14(20-4)23-9-8-22-13-11(16(17,18)19)6-5-7-21-13/h5-7H,8-10H2,1-4H3,(H,21,22)(H,25,26)(H2,20,23,24) |
| InChIKey | YADDNANWOMIYEA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 90.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|