C18H21F4N5 — CID 111362643
1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine (PubChem CID 111362643) has the molecular formula C18H21F4N5 and a molecular weight of 383.39 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine.
| Compound Name | 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111362643 |
| Molecular Formula | C18H21F4N5 |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine |
| SMILES | C/N=C(/NCCNc1ncccc1C(F)(F)F)NCCc1ccccc1F |
| InChI | InChI=1S/C18H21F4N5/c1-23-17(26-10-8-13-5-2-3-7-15(13)19)27-12-11-25-16-14(18(20,21)22)6-4-9-24-16/h2-7,9H,8,10-12H2,1H3,(H,24,25)(H2,23,26,27) |
| InChIKey | WFMJAROZUVNISI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|