C14H22F3N5 — CID 110944156
1-butan-2-yl-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine (PubChem CID 110944156) has the molecular formula C14H22F3N5 and a molecular weight of 317.36 g/mol. Its IUPAC name is 1-butan-2-yl-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine.
| Compound Name | 1-butan-2-yl-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 110944156 |
| Molecular Formula | C14H22F3N5 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 1-butan-2-yl-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine |
| SMILES | CCC(C)N/C(=N\C)NCCNc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C14H22F3N5/c1-4-10(2)22-13(18-3)21-9-8-20-12-11(14(15,16)17)6-5-7-19-12/h5-7,10H,4,8-9H2,1-3H3,(H,19,20)(H2,18,21,22) |
| InChIKey | JYNOVZNYBSBSIX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|