C19H32F3IN6O — CID 111369580
2-methyl-1-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide (PubChem CID 111369580) has the molecular formula C19H32F3IN6O and a molecular weight of 544.40 g/mol. Its IUPAC name is 2-methyl-1-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111369580 |
| Molecular Formula | C19H32F3IN6O |
| Molecular Weight | 544.40 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | 2-methyl-1-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNc1ncccc1C(F)(F)F)NCC1CN(CC(C)C)CCO1.I |
| InChI | InChI=1S/C19H31F3N6O.HI/c1-14(2)12-28-9-10-29-15(13-28)11-27-18(23-3)26-8-7-25-17-16(19(20,21)22)5-4-6-24-17;/h4-6,14-15H,7-13H2,1-3H3,(H,24,25)(H2,23,26,27);1H |
| InChIKey | SPFQXPIDFATJLL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|