C18H30N6O2 — CID 111369603
2-[[N'-methyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]carbamimidoyl]amino]-N-pyridin-3-ylacetamide (PubChem CID 111369603) has the molecular formula C18H30N6O2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-[[N'-methyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]carbamimidoyl]amino]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[[N'-methyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]carbamimidoyl]amino]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 111369603 |
| Molecular Formula | C18H30N6O2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 2-[[N'-methyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]carbamimidoyl]amino]-N-pyridin-3-ylacetamide |
| SMILES | C/N=C(\NCC(=O)Nc1cccnc1)NCC1CN(CC(C)C)CCO1 |
| InChI | InChI=1S/C18H30N6O2/c1-14(2)12-24-7-8-26-16(13-24)10-21-18(19-3)22-11-17(25)23-15-5-4-6-20-9-15/h4-6,9,14,16H,7-8,10-13H2,1-3H3,(H,23,25)(H2,19,21,22) |
| InChIKey | USDKKQYXLXSIPN-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|