C23H36N6O — CID 111369633
1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-methyl-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine (PubChem CID 111369633) has the molecular formula C23H36N6O and a molecular weight of 412.58 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-methyl-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine.
| Compound Name | 1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-methyl-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111369633 |
| Molecular Formula | C23H36N6O |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | 1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-methyl-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine |
| SMILES | C/N=C(\NCc1c(C)nn(-c2ccccc2)c1C)NCC1CN(CC(C)C)CCO1 |
| InChI | InChI=1S/C23H36N6O/c1-17(2)15-28-11-12-30-21(16-28)13-25-23(24-5)26-14-22-18(3)27-29(19(22)4)20-9-7-6-8-10-20/h6-10,17,21H,11-16H2,1-5H3,(H2,24,25,26) |
| InChIKey | ARYJVPFMTQBCRJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|