C24H38IN5O — CID 111624473
1-[(2-tert-butyloxan-3-yl)methyl]-3-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111624473) has the molecular formula C24H38IN5O and a molecular weight of 539.51 g/mol. Its IUPAC name is 1-[(2-tert-butyloxan-3-yl)methyl]-3-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111624473 |
| Molecular Formula | C24H38IN5O |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1c(C)nn(-c2ccccc2)c1C)NCC1CCCOC1C(C)(C)C.I |
| InChI | InChI=1S/C24H37N5O.HI/c1-17-21(18(2)29(28-17)20-12-8-7-9-13-20)16-27-23(25-6)26-15-19-11-10-14-30-22(19)24(3,4)5;/h7-9,12-13,19,22H,10-11,14-16H2,1-6H3,(H2,25,26,27);1H |
| InChIKey | WQRJENVURFADTC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|