C20H32F2IN3O — CID 111623835
1-[(2-tert-butyloxan-3-yl)methyl]-3-[2-(2,6-difluorophenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111623835) has the molecular formula C20H32F2IN3O and a molecular weight of 495.40 g/mol. Its IUPAC name is 1-[(2-tert-butyloxan-3-yl)methyl]-3-[2-(2,6-difluorophenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-[2-(2,6-difluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111623835 |
| Molecular Formula | C20H32F2IN3O |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-[2-(2,6-difluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1c(F)cccc1F)NCC1CCCOC1C(C)(C)C.I |
| InChI | InChI=1S/C20H31F2N3O.HI/c1-20(2,3)18-14(7-6-12-26-18)13-25-19(23-4)24-11-10-15-16(21)8-5-9-17(15)22;/h5,8-9,14,18H,6-7,10-13H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | MIDQZWRWCPTWMZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|