C20H34IN5O3 — CID 111622941
1-[(2-tert-butyloxan-3-yl)methyl]-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide (PubChem CID 111622941) has the molecular formula C20H34IN5O3 and a molecular weight of 519.43 g/mol. Its IUPAC name is 1-[(2-tert-butyloxan-3-yl)methyl]-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-tert-butyloxan-3-yl)methyl]-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111622941 |
| Molecular Formula | C20H34IN5O3 |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 1-[(2-tert-butyloxan-3-yl)methyl]-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCNc1ccccc1[N+](=O)[O-])NCC1CCCOC1C(C)(C)C.I |
| InChI | InChI=1S/C20H33N5O3.HI/c1-20(2,3)18-15(8-7-13-28-18)14-24-19(21-4)23-12-11-22-16-9-5-6-10-17(16)25(26)27;/h5-6,9-10,15,18,22H,7-8,11-14H2,1-4H3,(H2,21,23,24);1H |
| InChIKey | LJFKVLDJNDEMMO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|