C18H36N4O2 — CID 111623824
N-[2-[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide (PubChem CID 111623824) has the molecular formula C18H36N4O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is N-[2-[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 111623824 |
| Molecular Formula | C18H36N4O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | N-[2-[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide |
| SMILES | C/N=C(\NCCNC(=O)C(C)C)NCC1CCCOC1C(C)(C)C |
| InChI | InChI=1S/C18H36N4O2/c1-13(2)16(23)20-9-10-21-17(19-6)22-12-14-8-7-11-24-15(14)18(3,4)5/h13-15H,7-12H2,1-6H3,(H,20,23)(H2,19,21,22) |
| InChIKey | NHPFRVGNFSSETI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|