C18H33N5O — CID 111623268
1-[(2-tert-butyloxan-3-yl)methyl]-3-(3-imidazol-1-ylpropyl)-2-methylguanidine (PubChem CID 111623268) has the molecular formula C18H33N5O and a molecular weight of 335.50 g/mol. Its IUPAC name is 1-[(2-tert-butyloxan-3-yl)methyl]-3-(3-imidazol-1-ylpropyl)-2-methylguanidine.
| Compound Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-(3-imidazol-1-ylpropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111623268 |
| Molecular Formula | C18H33N5O |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.27 |
| IUPAC Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-(3-imidazol-1-ylpropyl)-2-methylguanidine |
| SMILES | C/N=C(\NCCCn1ccnc1)NCC1CCCOC1C(C)(C)C |
| InChI | InChI=1S/C18H33N5O/c1-18(2,3)16-15(7-5-12-24-16)13-22-17(19-4)21-8-6-10-23-11-9-20-14-23/h9,11,14-16H,5-8,10,12-13H2,1-4H3,(H2,19,21,22) |
| InChIKey | UBDMIWISZKHSFZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|