C12H21N5 — CID 119151281
1-(cyclobutylmethyl)-3-(2-imidazol-1-ylethyl)-2-methylguanidine (PubChem CID 119151281) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-3-(2-imidazol-1-ylethyl)-2-methylguanidine.
| Compound Name | 1-(cyclobutylmethyl)-3-(2-imidazol-1-ylethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 119151281 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 1-(cyclobutylmethyl)-3-(2-imidazol-1-ylethyl)-2-methylguanidine |
| SMILES | C/N=C(/NCCn1ccnc1)NCC1CCC1 |
| InChI | InChI=1S/C12H21N5/c1-13-12(16-9-11-3-2-4-11)15-6-8-17-7-5-14-10-17/h5,7,10-11H,2-4,6,8-9H2,1H3,(H2,13,15,16) |
| InChIKey | FXMOPQDZZJMECT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|