C13H24IN5O — CID 119151460
1-(2-imidazol-1-ylethyl)-2-methyl-3-(oxan-4-ylmethyl)guanidine;hydroiodide (PubChem CID 119151460) has the molecular formula C13H24IN5O and a molecular weight of 393.27 g/mol. Its IUPAC name is 1-(2-imidazol-1-ylethyl)-2-methyl-3-(oxan-4-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(2-imidazol-1-ylethyl)-2-methyl-3-(oxan-4-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119151460 |
| Molecular Formula | C13H24IN5O |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 1-(2-imidazol-1-ylethyl)-2-methyl-3-(oxan-4-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCn1ccnc1)NCC1CCOCC1.I |
| InChI | InChI=1S/C13H23N5O.HI/c1-14-13(16-5-7-18-6-4-15-11-18)17-10-12-2-8-19-9-3-12;/h4,6,11-12H,2-3,5,7-10H2,1H3,(H2,14,16,17);1H |
| InChIKey | WLHYDYOQTUOXLB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|