C17H29IN6O2 — CID 111261674
1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide (PubChem CID 111261674) has the molecular formula C17H29IN6O2 and a molecular weight of 476.36 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111261674 |
| Molecular Formula | C17H29IN6O2 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide |
| SMILES | CCN1CCCC1CN/C(=N\C)NCCNc1ccccc1[N+](=O)[O-].I |
| InChI | InChI=1S/C17H28N6O2.HI/c1-3-22-12-6-7-14(22)13-21-17(18-2)20-11-10-19-15-8-4-5-9-16(15)23(24)25;/h4-5,8-9,14,19H,3,6-7,10-13H2,1-2H3,(H2,18,20,21);1H |
| InChIKey | FDVLGQQGCSXGRT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|