C20H30N6 — CID 111261939
1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[2-(quinolin-2-ylamino)ethyl]guanidine (PubChem CID 111261939) has the molecular formula C20H30N6 and a molecular weight of 354.50 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[2-(quinolin-2-ylamino)ethyl]guanidine.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[2-(quinolin-2-ylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 111261939 |
| Molecular Formula | C20H30N6 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[2-(quinolin-2-ylamino)ethyl]guanidine |
| SMILES | CCN1CCCC1CN/C(=N\C)NCCNc1ccc2ccccc2n1 |
| InChI | InChI=1S/C20H30N6/c1-3-26-14-6-8-17(26)15-24-20(21-2)23-13-12-22-19-11-10-16-7-4-5-9-18(16)25-19/h4-5,7,9-11,17H,3,6,8,12-15H2,1-2H3,(H,22,25)(H2,21,23,24) |
| InChIKey | GPVAGFOXGNWLLK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 64.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|