C17H24IN5 — CID 111961988
2-methyl-1-(2-methylcyclopropyl)-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide (PubChem CID 111961988) has the molecular formula C17H24IN5 and a molecular weight of 425.32 g/mol. Its IUPAC name is 2-methyl-1-(2-methylcyclopropyl)-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methylcyclopropyl)-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111961988 |
| Molecular Formula | C17H24IN5 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2-methyl-1-(2-methylcyclopropyl)-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCNc1ccc2ccccc2n1)NC1CC1C.I |
| InChI | InChI=1S/C17H23N5.HI/c1-12-11-15(12)22-17(18-2)20-10-9-19-16-8-7-13-5-3-4-6-14(13)21-16;/h3-8,12,15H,9-11H2,1-2H3,(H,19,21)(H2,18,20,22);1H |
| InChIKey | RUYVNNSTUSZFSO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|