C19H29N5O2 — CID 111405947
1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[2-(quinolin-2-ylamino)ethyl]guanidine (PubChem CID 111405947) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[2-(quinolin-2-ylamino)ethyl]guanidine.
| Compound Name | 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[2-(quinolin-2-ylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 111405947 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[2-(quinolin-2-ylamino)ethyl]guanidine |
| SMILES | C/N=C(\NCCCOCCOC)NCCNc1ccc2ccccc2n1 |
| InChI | InChI=1S/C19H29N5O2/c1-20-19(22-10-5-13-26-15-14-25-2)23-12-11-21-18-9-8-16-6-3-4-7-17(16)24-18/h3-4,6-9H,5,10-15H2,1-2H3,(H,21,24)(H2,20,22,23) |
| InChIKey | VKSVOSVGWGJTPH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|