C22H33N5O2 — CID 111644544
2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[2-(quinolin-2-ylamino)ethyl]guanidine (PubChem CID 111644544) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[2-(quinolin-2-ylamino)ethyl]guanidine.
| Compound Name | 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[2-(quinolin-2-ylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 111644544 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[2-(quinolin-2-ylamino)ethyl]guanidine |
| SMILES | C/N=C(\NCCCOCC1CCOCC1)NCCNc1ccc2ccccc2n1 |
| InChI | InChI=1S/C22H33N5O2/c1-23-22(25-11-4-14-29-17-18-9-15-28-16-10-18)26-13-12-24-21-8-7-19-5-2-3-6-20(19)27-21/h2-3,5-8,18H,4,9-17H2,1H3,(H,24,27)(H2,23,25,26) |
| InChIKey | NHVIMPIDRGSSJV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|