C21H32IN5O2 — CID 111647999
2-methyl-1-[3-(oxolan-3-ylmethoxy)propyl]-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide (PubChem CID 111647999) has the molecular formula C21H32IN5O2 and a molecular weight of 513.42 g/mol. Its IUPAC name is 2-methyl-1-[3-(oxolan-3-ylmethoxy)propyl]-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-(oxolan-3-ylmethoxy)propyl]-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111647999 |
| Molecular Formula | C21H32IN5O2 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 2-methyl-1-[3-(oxolan-3-ylmethoxy)propyl]-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CCOC1)NCCNc1ccc2ccccc2n1.I |
| InChI | InChI=1S/C21H31N5O2.HI/c1-22-21(24-10-4-13-27-15-17-9-14-28-16-17)25-12-11-23-20-8-7-18-5-2-3-6-19(18)26-20;/h2-3,5-8,17H,4,9-16H2,1H3,(H,23,26)(H2,22,24,25);1H |
| InChIKey | JMIBNOIDRQYUMN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|