C17H24IN5O2S — CID 111141002
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide (PubChem CID 111141002) has the molecular formula C17H24IN5O2S and a molecular weight of 489.38 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111141002 |
| Molecular Formula | C17H24IN5O2S |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(quinolin-2-ylamino)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCNc1ccc2ccccc2n1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C17H23N5O2S.HI/c1-18-17(21-14-8-11-25(23,24)12-14)20-10-9-19-16-7-6-13-4-2-3-5-15(13)22-16;/h2-7,14H,8-12H2,1H3,(H,19,22)(H2,18,20,21);1H |
| InChIKey | BUICJOJBZQCAQY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|