C9H20IN3O2S2 — CID 111141602
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111141602) has the molecular formula C9H20IN3O2S2 and a molecular weight of 393.32 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111141602 |
| Molecular Formula | C9H20IN3O2S2 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCSC)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C9H19N3O2S2.HI/c1-10-9(11-4-5-15-2)12-8-3-6-16(13,14)7-8;/h8H,3-7H2,1-2H3,(H2,10,11,12);1H |
| InChIKey | ULASNJGRBGPGEI-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|