C13H26IN3O4S — CID 111141634
methyl 6-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]hexanoate;hydroiodide (PubChem CID 111141634) has the molecular formula C13H26IN3O4S and a molecular weight of 447.34 g/mol. Its IUPAC name is methyl 6-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]hexanoate;hydroiodide.
| Compound Name | methyl 6-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]hexanoate;hydroiodide |
|---|---|
| PubChem CID | 111141634 |
| Molecular Formula | C13H26IN3O4S |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | methyl 6-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]hexanoate;hydroiodide |
| SMILES | C/N=C(\NCCCCCC(=O)OC)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C13H25N3O4S.HI/c1-14-13(16-11-7-9-21(18,19)10-11)15-8-5-3-4-6-12(17)20-2;/h11H,3-10H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | JTPPSZQAXVWCFW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|