C15H30IN3O4S — CID 111143171
ethyl 7-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]heptanoate;hydroiodide (PubChem CID 111143171) has the molecular formula C15H30IN3O4S and a molecular weight of 475.39 g/mol. Its IUPAC name is ethyl 7-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]heptanoate;hydroiodide.
| Compound Name | ethyl 7-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]heptanoate;hydroiodide |
|---|---|
| PubChem CID | 111143171 |
| Molecular Formula | C15H30IN3O4S |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | ethyl 7-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]heptanoate;hydroiodide |
| SMILES | CCOC(=O)CCCCCCN/C(=N\C)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C15H29N3O4S.HI/c1-3-22-14(19)8-6-4-5-7-10-17-15(16-2)18-13-9-11-23(20,21)12-13;/h13H,3-12H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | ZTSYGRZTVLSAJA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|