C15H32IN3O2 — CID 111151917
ethyl 7-[(N-butyl-N'-methylcarbamimidoyl)amino]heptanoate;hydroiodide (PubChem CID 111151917) has the molecular formula C15H32IN3O2 and a molecular weight of 413.34 g/mol. Its IUPAC name is ethyl 7-[(N-butyl-N'-methylcarbamimidoyl)amino]heptanoate;hydroiodide.
| Compound Name | ethyl 7-[(N-butyl-N'-methylcarbamimidoyl)amino]heptanoate;hydroiodide |
|---|---|
| PubChem CID | 111151917 |
| Molecular Formula | C15H32IN3O2 |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | ethyl 7-[(N-butyl-N'-methylcarbamimidoyl)amino]heptanoate;hydroiodide |
| SMILES | CCCCN/C(=N\C)NCCCCCCC(=O)OCC.I |
| InChI | InChI=1S/C15H31N3O2.HI/c1-4-6-12-17-15(16-3)18-13-10-8-7-9-11-14(19)20-5-2;/h4-13H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | KFRQEVPNQNKBIJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|