C18H38N4O3 — CID 111651816
ethyl 7-[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]heptanoate (PubChem CID 111651816) has the molecular formula C18H38N4O3 and a molecular weight of 358.53 g/mol. Its IUPAC name is ethyl 7-[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]heptanoate.
| Compound Name | ethyl 7-[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]heptanoate |
|---|---|
| PubChem CID | 111651816 |
| Molecular Formula | C18H38N4O3 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | ethyl 7-[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]heptanoate |
| SMILES | CCOC(=O)CCCCCCN/C(=N\C)NCCN(C)CCCOC |
| InChI | InChI=1S/C18H38N4O3/c1-5-25-17(23)11-8-6-7-9-12-20-18(19-2)21-13-15-22(3)14-10-16-24-4/h5-16H2,1-4H3,(H2,19,20,21) |
| InChIKey | OFBCIXMXBWRKLG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|