C15H31IN4O3S — CID 111161956
N-(1,1-dioxothiolan-3-yl)-3-[(N-hexyl-N'-methylcarbamimidoyl)amino]propanamide;hydroiodide (PubChem CID 111161956) has the molecular formula C15H31IN4O3S and a molecular weight of 474.41 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[(N-hexyl-N'-methylcarbamimidoyl)amino]propanamide;hydroiodide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[(N-hexyl-N'-methylcarbamimidoyl)amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111161956 |
| Molecular Formula | C15H31IN4O3S |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[(N-hexyl-N'-methylcarbamimidoyl)amino]propanamide;hydroiodide |
| SMILES | CCCCCCN/C(=N\C)NCCC(=O)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C15H30N4O3S.HI/c1-3-4-5-6-9-17-15(16-2)18-10-7-14(20)19-13-8-11-23(21,22)12-13;/h13H,3-12H2,1-2H3,(H,19,20)(H2,16,17,18);1H |
| InChIKey | IQAHXURALGBQIF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|