C14H29IN4O3S2 — CID 111610979
N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111610979) has the molecular formula C14H29IN4O3S2 and a molecular weight of 492.45 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111610979 |
| Molecular Formula | C14H29IN4O3S2 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(/NCCC(=O)NC1CCS(=O)(=O)C1)NCC(C)(C)SC.I |
| InChI | InChI=1S/C14H28N4O3S2.HI/c1-14(2,22-4)10-17-13(15-3)16-7-5-12(19)18-11-6-8-23(20,21)9-11;/h11H,5-10H2,1-4H3,(H,18,19)(H2,15,16,17);1H |
| InChIKey | LSWLGLYWWAUSRH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|