C17H23F3N4O3S — CID 111267241
N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]propanamide (PubChem CID 111267241) has the molecular formula C17H23F3N4O3S and a molecular weight of 420.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111267241 |
| Molecular Formula | C17H23F3N4O3S |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]propanamide |
| SMILES | C/N=C(\NCCC(=O)NC1CCS(=O)(=O)C1)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H23F3N4O3S/c1-21-16(23-10-12-3-2-4-13(9-12)17(18,19)20)22-7-5-15(25)24-14-6-8-28(26,27)11-14/h2-4,9,14H,5-8,10-11H2,1H3,(H,24,25)(H2,21,22,23) |
| InChIKey | JGCQQMIEABNHSU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|