C18H25F3N4O3S — CID 111299639
3-[[N,N'-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 111299639) has the molecular formula C18H25F3N4O3S and a molecular weight of 434.48 g/mol. Its IUPAC name is 3-[[N,N'-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-[[N,N'-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 111299639 |
| Molecular Formula | C18H25F3N4O3S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 3-[[N,N'-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | C/N=C(\NCCC(=O)NC1CCS(=O)(=O)C1)N(C)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H25F3N4O3S/c1-22-17(23-9-7-16(26)24-15-8-10-29(27,28)12-15)25(2)11-13-3-5-14(6-4-13)18(19,20)21/h3-6,15H,7-12H2,1-2H3,(H,22,23)(H,24,26) |
| InChIKey | OCHMGGIBBOMJBZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|