C18H28N4O4S — CID 111273215
3-[[N,N'-dimethyl-N-(2-phenoxyethyl)carbamimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 111273215) has the molecular formula C18H28N4O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is 3-[[N,N'-dimethyl-N-(2-phenoxyethyl)carbamimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-[[N,N'-dimethyl-N-(2-phenoxyethyl)carbamimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 111273215 |
| Molecular Formula | C18H28N4O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 3-[[N,N'-dimethyl-N-(2-phenoxyethyl)carbamimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | C/N=C(\NCCC(=O)NC1CCS(=O)(=O)C1)N(C)CCOc1ccccc1 |
| InChI | InChI=1S/C18H28N4O4S/c1-19-18(22(2)11-12-26-16-6-4-3-5-7-16)20-10-8-17(23)21-15-9-13-27(24,25)14-15/h3-7,15H,8-14H2,1-2H3,(H,19,20)(H,21,23) |
| InChIKey | OLSSPZQVMJXUQQ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|