C15H25N5O3S2 — CID 109423984
3-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 109423984) has the molecular formula C15H25N5O3S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 3-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 109423984 |
| Molecular Formula | C15H25N5O3S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 3-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | C/N=C(/NCCC(=O)NC1CCS(=O)(=O)C1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C15H25N5O3S2/c1-11-18-13(9-24-11)8-20(3)15(16-2)17-6-4-14(21)19-12-5-7-25(22,23)10-12/h9,12H,4-8,10H2,1-3H3,(H,16,17)(H,19,21) |
| InChIKey | YXJQYYISRYMJTR-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|