C18H25BrIN5OS — CID 109423505
N-(4-bromo-2-methylphenyl)-3-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 109423505) has the molecular formula C18H25BrIN5OS and a molecular weight of 566.31 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-3-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(4-bromo-2-methylphenyl)-3-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 109423505 |
| Molecular Formula | C18H25BrIN5OS |
| Molecular Weight | 566.31 g/mol |
| Exact Mass | 565.00 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-3-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(/NCCC(=O)Nc1ccc(Br)cc1C)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C18H24BrN5OS.HI/c1-12-9-14(19)5-6-16(12)23-17(25)7-8-21-18(20-3)24(4)10-15-11-26-13(2)22-15;/h5-6,9,11H,7-8,10H2,1-4H3,(H,20,21)(H,23,25);1H |
| InChIKey | JPQVATVWKFPYGQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|