C15H28IN5S — CID 109422243
3-[2-[cyclopropyl(ethyl)amino]ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109422243) has the molecular formula C15H28IN5S and a molecular weight of 437.40 g/mol. Its IUPAC name is 3-[2-[cyclopropyl(ethyl)amino]ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[2-[cyclopropyl(ethyl)amino]ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109422243 |
| Molecular Formula | C15H28IN5S |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 3-[2-[cyclopropyl(ethyl)amino]ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN(CCN/C(=N\C)N(C)Cc1csc(C)n1)C1CC1.I |
| InChI | InChI=1S/C15H27N5S.HI/c1-5-20(14-6-7-14)9-8-17-15(16-3)19(4)10-13-11-21-12(2)18-13;/h11,14H,5-10H2,1-4H3,(H,16,17);1H |
| InChIKey | YNJGFXVDHZMURS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|