C15H22N2O4S — CID 94026963
1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-phenoxybutyl)urea (PubChem CID 94026963) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-phenoxybutyl)urea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-phenoxybutyl)urea |
|---|---|
| PubChem CID | 94026963 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-phenoxybutyl)urea |
| SMILES | O=C(NCCCCOc1ccccc1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H22N2O4S/c18-15(17-13-8-11-22(19,20)12-13)16-9-4-5-10-21-14-6-2-1-3-7-14/h1-3,6-7,13H,4-5,8-12H2,(H2,16,17,18)/t13-/m1/s1 |
| InChIKey | XMOUQBAMWHXWDS-CYBMUJFWSA-N |
| XLogP | 1.33 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|