C14H20N2O5S — CID 108890802
1-(1,1-dioxothiolan-3-yl)-3-[(4-ethoxyphenoxy)methyl]urea (PubChem CID 108890802) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[(4-ethoxyphenoxy)methyl]urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[(4-ethoxyphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108890802 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[(4-ethoxyphenoxy)methyl]urea |
| SMILES | CCOc1ccc(OCNC(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C14H20N2O5S/c1-2-20-12-3-5-13(6-4-12)21-10-15-14(17)16-11-7-8-22(18,19)9-11/h3-6,11H,2,7-10H2,1H3,(H2,15,16,17) |
| InChIKey | ZORKAVMMAGOOGH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|