C15H22N2O6S2 — CID 113155273
N-(1,1-dioxothiolan-3-yl)-2-(4-ethoxy-N-methylsulfonylanilino)acetamide (PubChem CID 113155273) has the molecular formula C15H22N2O6S2 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(4-ethoxy-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(4-ethoxy-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 113155273 |
| Molecular Formula | C15H22N2O6S2 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(4-ethoxy-N-methylsulfonylanilino)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)NC2CCS(=O)(=O)C2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H22N2O6S2/c1-3-23-14-6-4-13(5-7-14)17(24(2,19)20)10-15(18)16-12-8-9-25(21,22)11-12/h4-7,12H,3,8-11H2,1-2H3,(H,16,18) |
| InChIKey | DHRQVPQRBOXEJT-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |