C14H20N2O5S2 — CID 113153702
N-(1,1-dioxothiolan-3-yl)-2-(2-methyl-N-methylsulfonylanilino)acetamide (PubChem CID 113153702) has the molecular formula C14H20N2O5S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(2-methyl-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(2-methyl-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 113153702 |
| Molecular Formula | C14H20N2O5S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(2-methyl-N-methylsulfonylanilino)acetamide |
| SMILES | Cc1ccccc1N(CC(=O)NC1CCS(=O)(=O)C1)S(C)(=O)=O |
| InChI | InChI=1S/C14H20N2O5S2/c1-11-5-3-4-6-13(11)16(22(2,18)19)9-14(17)15-12-7-8-23(20,21)10-12/h3-6,12H,7-10H2,1-2H3,(H,15,17) |
| InChIKey | FSDDWNAPMZKUNQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |