C22H29N3O3 — CID 108890906
1-(1-benzylpiperidin-4-yl)-3-[(4-ethoxyphenoxy)methyl]urea (PubChem CID 108890906) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-[(4-ethoxyphenoxy)methyl]urea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-[(4-ethoxyphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108890906 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-[(4-ethoxyphenoxy)methyl]urea |
| SMILES | CCOc1ccc(OCNC(=O)NC2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H29N3O3/c1-2-27-20-8-10-21(11-9-20)28-17-23-22(26)24-19-12-14-25(15-13-19)16-18-6-4-3-5-7-18/h3-11,19H,2,12-17H2,1H3,(H2,23,24,26) |
| InChIKey | QVNNDHVPDOHRFW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|