C23H32N2O3 — CID 4969396
1-[(1-benzylpiperidin-4-yl)amino]-3-(4-ethoxyphenoxy)propan-2-ol (PubChem CID 4969396) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-[(1-benzylpiperidin-4-yl)amino]-3-(4-ethoxyphenoxy)propan-2-ol.
| Compound Name | 1-[(1-benzylpiperidin-4-yl)amino]-3-(4-ethoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 4969396 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 1-[(1-benzylpiperidin-4-yl)amino]-3-(4-ethoxyphenoxy)propan-2-ol |
| SMILES | CCOc1ccc(OCC(O)CNC2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H32N2O3/c1-2-27-22-8-10-23(11-9-22)28-18-21(26)16-24-20-12-14-25(15-13-20)17-19-6-4-3-5-7-19/h3-11,20-21,24,26H,2,12-18H2,1H3 |
| InChIKey | FFZPOJBEZXPEIS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |