C22H38N2O2 — CID 166238807
1-(4-tert-butylphenoxy)-3-[(1-tert-butylpiperidin-4-yl)amino]propan-2-ol (PubChem CID 166238807) has the molecular formula C22H38N2O2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 1-(4-tert-butylphenoxy)-3-[(1-tert-butylpiperidin-4-yl)amino]propan-2-ol.
| Compound Name | 1-(4-tert-butylphenoxy)-3-[(1-tert-butylpiperidin-4-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 166238807 |
| Molecular Formula | C22H38N2O2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | 1-(4-tert-butylphenoxy)-3-[(1-tert-butylpiperidin-4-yl)amino]propan-2-ol |
| SMILES | CC(C)(C)c1ccc(OCC(O)CNC2CCN(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C22H38N2O2/c1-21(2,3)17-7-9-20(10-8-17)26-16-19(25)15-23-18-11-13-24(14-12-18)22(4,5)6/h7-10,18-19,23,25H,11-16H2,1-6H3 |
| InChIKey | ONKSVXNIEMTBGS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |