C21H34N2O3 — CID 166238845
4-[[3-(4-tert-butylphenoxy)-2-hydroxypropyl]amino]-N-methylcyclohexane-1-carboxamide (PubChem CID 166238845) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is 4-[[3-(4-tert-butylphenoxy)-2-hydroxypropyl]amino]-N-methylcyclohexane-1-carboxamide.
| Compound Name | 4-[[3-(4-tert-butylphenoxy)-2-hydroxypropyl]amino]-N-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 166238845 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 4-[[3-(4-tert-butylphenoxy)-2-hydroxypropyl]amino]-N-methylcyclohexane-1-carboxamide |
| SMILES | CNC(=O)C1CCC(NCC(O)COc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C21H34N2O3/c1-21(2,3)16-7-11-19(12-8-16)26-14-18(24)13-23-17-9-5-15(6-10-17)20(25)22-4/h7-8,11-12,15,17-18,23-24H,5-6,9-10,13-14H2,1-4H3,(H,22,25) |
| InChIKey | VYNUXZUQKCXJSX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |