C21H33NO3 — CID 122031136
4-[[2-methyl-2-[4-(2-methylpropoxy)phenyl]propyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 122031136) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is 4-[[2-methyl-2-[4-(2-methylpropoxy)phenyl]propyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-methyl-2-[4-(2-methylpropoxy)phenyl]propyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122031136 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | 4-[[2-methyl-2-[4-(2-methylpropoxy)phenyl]propyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)COc1ccc(C(C)(C)CNC2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C21H33NO3/c1-15(2)13-25-19-11-7-17(8-12-19)21(3,4)14-22-18-9-5-16(6-10-18)20(23)24/h7-8,11-12,15-16,18,22H,5-6,9-10,13-14H2,1-4H3,(H,23,24) |
| InChIKey | NZFSBLNVUWGNBS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |